CymitQuimica logo

CAS 70596-08-6

:

5-Ethyl-2-thiopheneacetic acid

Description:
5-Ethyl-2-thiopheneacetic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features an ethyl group and an acetic acid moiety, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the thiophene ring imparts notable stability and reactivity, making it useful in various chemical syntheses and applications. The carboxylic acid functional group in 5-Ethyl-2-thiopheneacetic acid allows for hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its derivatives can be explored for applications in materials science and organic electronics due to the electronic properties of the thiophene unit. Overall, 5-Ethyl-2-thiopheneacetic acid is a versatile compound with potential applications across multiple fields in chemistry and materials science.
Formula:C8H10O2S
InChI:InChI=1S/C8H10O2S/c1-2-6-3-4-7(11-6)5-8(9)10/h3-4H,2,5H2,1H3,(H,9,10)
InChI key:InChIKey=LHGIEVDPYLVDOI-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1SC(CC)=CC1
Synonyms:
  • 2-Thiopheneacetic acid, 5-ethyl-
  • 2-(5-Ethylthiophen-2-yl)acetic acid
  • 5-Ethyl-2-thiopheneacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.