CAS 70597-91-0
:1,3-bis(3-methoxyphenyl)propane-1,3-dione
Description:
1,3-bis(3-methoxyphenyl)propane-1,3-dione, identified by its CAS number 70597-91-0, is an organic compound characterized by its structure, which features two methoxy-substituted phenyl groups attached to a propane-1,3-dione backbone. This compound typically exhibits properties associated with diketones, including the potential for tautomerism and reactivity in various chemical reactions, such as condensation and oxidation. The presence of methoxy groups enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for applications in organic synthesis and materials science. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its stability, reactivity, and potential applications are influenced by the specific arrangement of functional groups and the overall molecular geometry. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C17H16O4
InChI:InChI=1/C17H16O4/c1-20-14-7-3-5-12(9-14)16(18)11-17(19)13-6-4-8-15(10-13)21-2/h3-10H,11H2,1-2H3
SMILES:COc1cccc(c1)C(=O)CC(=O)c1cccc(c1)OC
Synonyms:- 1,3-Di-(3-methoxyphenyl)-1,3-propanedione
- 1,3-Propanedione, 1,3-Bis(3-Methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.