CAS 70598-48-0
:4-chloro-2-ethyl-6-methylaniline
Description:
4-Chloro-2-ethyl-6-methylaniline is an organic compound belonging to the class of anilines, which are aromatic amines characterized by the presence of an amino group (-NH2) attached to a benzene ring. This particular compound features a chloro substituent at the para position, an ethyl group at the ortho position, and a methyl group at the meta position relative to the amino group. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents and limited solubility in water, depending on its molecular structure. The presence of the chloro group can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, due to the presence of both alkyl and halogen substituents, it may exhibit unique biological activities, which could be of interest in pharmaceutical or agrochemical applications. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity.
Formula:C9H12ClN
InChI:InChI=1/C9H12ClN/c1-3-7-5-8(10)4-6(2)9(7)11/h4-5H,3,11H2,1-2H3
InChI key:InChIKey=WEGUQBDLWKTMOD-UHFFFAOYSA-N
SMILES:C(C)C1=C(N)C(C)=CC(Cl)=C1
Synonyms:- Benzenamine, 4-chloro-2-ethyl-6-methyl-
- 4-Chloro-2-ethyl-6-methylaniline
- 4-Chloro-2-ethyl-6-methylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-2-ethyl-6-methylaniline
CAS:Controlled ProductApplications 4-Chloro-2-ethyl-6-methylaniline is a reagent used in the synthesis of nanosized dendritic polyethylene.
References Yuan, J. et al.: Inorg. Chem. Acta., 400, 99 (2013);Formula:C9H12ClNColor and Shape:NeatMolecular weight:169.651
