CAS 706-25-2
:(4-fluorobenzyl)(trimethyl)silane
Description:
(4-Fluorobenzyl)(trimethyl)silane, with the CAS number 706-25-2, is an organosilicon compound characterized by the presence of a fluorobenzyl group attached to a trimethylsilyl moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its volatility and low viscosity. The presence of the fluorine atom in the benzyl group enhances its reactivity and can influence its physical properties, such as solubility and polarity. (4-Fluorobenzyl)(trimethyl)silane is often utilized in organic synthesis, particularly in the preparation of various silicon-containing compounds and as a reagent in cross-coupling reactions. Its trimethylsilyl group can serve as a protecting group for alcohols and amines, facilitating selective reactions in complex organic syntheses. Additionally, this compound may exhibit unique interactions in materials science and surface modification applications due to the presence of both silicon and fluorine, which can impart hydrophobic characteristics. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C10H15FSi
InChI:InChI=1/C10H15FSi/c1-12(2,3)8-9-4-6-10(11)7-5-9/h4-7H,8H2,1-3H3
SMILES:C[Si](C)(C)Cc1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.