CAS 7060-39-1

(2Z)-2-amino-3-phenylprop-2-enoic acid

Description:

(2Z)-2-amino-3-phenylprop-2-enoic acid, commonly known as phenylalanine, is an α-amino acid that plays a crucial role in the biosynthesis of proteins. It is characterized by the presence of an amino group (-NH2), a carboxylic acid group (-COOH), and a phenyl group attached to the β-carbon. This compound is classified as a non-polar, aromatic amino acid due to the hydrophobic nature of the phenyl group. It exists in a zwitterionic form at physiological pH, where the amino group is protonated and the carboxylic acid group is deprotonated. Phenylalanine is essential for humans, meaning it must be obtained through the diet, as it is a precursor for the synthesis of neurotransmitters such as dopamine, norepinephrine, and epinephrine. Additionally, it is involved in the production of melanin and is important for the proper functioning of various metabolic pathways. Its deficiency can lead to health issues, including phenylketonuria (PKU), a genetic disorder that affects the metabolism of phenylalanine.

Formula: C₉H₉NO₂

InChI: InChI=1/C9H9NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6H,10H2,(H,11,12)/b8-6-

SMILES: c1ccc(cc1)/C=C(/C(=O)O)\N

Dehydro Phenylalanine(cis/trans Mixture)

Controlled Product

CAS: 7060-39-1

Applications The α,β-dehydro analog for the corresponding natural amino acid Phenylalanine. It is used for stabilization of unusual structures in peptides.
References Porter, D.J.T., et al.: J. Biol. Chem., 262, 9154 (1987),

Formula: C₉H₉NO₂

Color and Shape: Neat

Molecular weight: 163.173

Ref: TR-D229995