CAS 70619-50-0

4-(4-Ethoxycarbonylphenyl)-3-thiosemicarbazide

Description:

4-(4-Ethoxycarbonylphenyl)-3-thiosemicarbazide is a chemical compound characterized by its thiosemicarbazide functional group, which is known for its diverse biological activities, including antimicrobial and anticancer properties. The compound features an ethoxycarbonyl group attached to a phenyl ring, enhancing its solubility and reactivity. Its structure includes a thiosemicarbazide moiety, which contains sulfur, nitrogen, and carbon, contributing to its potential as a ligand in coordination chemistry. The presence of the ethoxycarbonyl group may influence its pharmacokinetic properties, such as absorption and distribution. This compound is typically synthesized through the reaction of thiosemicarbazide with appropriate carbonyl compounds, and it may be utilized in various fields, including medicinal chemistry and agricultural applications. As with many thiosemicarbazides, it is essential to handle this compound with care due to potential toxicity and reactivity. Further studies are often conducted to explore its full range of biological activities and potential applications in drug development.

Formula: C₁₀H₁₃N₃O₂S

InChI: InChI=1/C10H13N3O2S/c1-2-15-9(14)7-3-5-8(6-4-7)12-10(16)13-11/h3-6H,2,11H2,1H3,(H2,12,13,16)

SMILES: CCOC(=O)c1ccc(cc1)NC(=NN)S

Synonyms:

• Ethyl 4-[(Hydrazinocarbonothioyl)Amino]Benzoate

4-(4-Ethoxycarbonylphenyl)-3-thiosemicarbazide

CAS: 70619-50-0

Formula: C₁₀H₁₃N₃O₂S

Color and Shape: Solid

Molecular weight: 239.29

Ref: 10-F018666