CymitQuimica logo

CAS 7062-15-9

:

2-Buten-1-ol, 4-(2-cyclohexen-1-yl)-3-methyl-, triester with boric acid(H3BO3)

Description:
2-Buten-1-ol, 4-(2-cyclohexen-1-yl)-3-methyl-, triester with boric acid (CAS 7062-15-9) is an organoboron compound characterized by the presence of a boron atom bonded to three ester groups derived from a specific alcohol. This compound features a butenol moiety, which contributes to its reactivity and potential applications in organic synthesis. The cyclohexenyl group adds to its structural complexity, influencing its physical and chemical properties, such as solubility and reactivity. Organoboron compounds are often utilized in various chemical reactions, including cross-coupling reactions, due to the unique properties of boron. The triester formation indicates that the compound may exhibit enhanced stability and reactivity compared to its parent alcohol. Additionally, the presence of multiple functional groups suggests potential applications in materials science, pharmaceuticals, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C33H51BO3
InChI:InChI=1S/C33H51BO3/c1-28(25-31-13-7-4-8-14-31)19-22-35-34(36-23-20-29(2)26-32-15-9-5-10-16-32)37-24-21-30(3)27-33-17-11-6-12-18-33/h7,9,11,13,15,17,19-21,31-33H,4-6,8,10,12,14,16,18,22-27H2,1-3H3
InChI key:InChIKey=WUONWPUKNLYZJE-UHFFFAOYSA-N
SMILES:C(C(=CCOB(OCC=C(CC1CCCC=C1)C)OCC=C(CC2CCCC=C2)C)C)C3CCCC=C3
Synonyms:
  • 2-Buten-1-ol, 4-(2-cyclohexen-1-yl)-3-methyl-, triester with boric acid(H3BO3)
  • 2-Buten-1-ol, 4-(2-cyclohexen-1-yl)-3-methyl-, borate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.