CymitQuimica logo

CAS 7062-20-6

:

5-(4-bromophenyl)-2-(prop-2-en-1-ylsulfanyl)-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6(1H,7H)-dione

Description:
5-(4-bromophenyl)-2-(prop-2-en-1-ylsulfanyl)-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6(1H,7H)-dione is a complex organic compound characterized by its unique structural features, which include a pyrimidoquinoline core and various functional groups. The presence of a bromophenyl group suggests potential for electrophilic substitution reactions, while the prop-2-en-1-ylsulfanyl moiety indicates reactivity associated with thiol and alkene functionalities. This compound may exhibit interesting biological activities due to its heterocyclic structure, which is often associated with pharmacological properties. The dione functional groups contribute to its potential as a chelating agent or in forming coordination complexes. Additionally, the compound's solubility and stability can be influenced by the bromine substituent and the overall molecular geometry. Its synthesis and reactivity can be explored in various organic reactions, making it a candidate for further research in medicinal chemistry and materials science. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential applications in drug development and other fields.
Formula:C20H18BrN3O2S
InChI:InChI=1/C20H18BrN3O2S/c1-2-10-27-20-23-18-17(19(26)24-20)15(11-6-8-12(21)9-7-11)16-13(22-18)4-3-5-14(16)25/h2,6-9,15H,1,3-5,10H2,(H2,22,23,24,26)
Synonyms:
  • pyrimido[4,5-b]quinoline-4,6(3H,7H)-dione, 5-(4-bromophenyl)-5,8,9,10-tetrahydro-2-(2-propen-1-ylthio)-
  • 2-(Allylsulfanyl)-5-(4-bromophenyl)-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6(3H,7H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.