CAS 7062-95-5

2-[(4-methylphenyl)sulfonyl]-1-pyridin-4-yl-1,2,3,4-tetrahydroisoquinoline

Description:

2-[(4-methylphenyl)sulfonyl]-1-pyridin-4-yl-1,2,3,4-tetrahydroisoquinoline, with the CAS number 7062-95-5, is a complex organic compound characterized by its unique structural features. It contains a tetrahydroisoquinoline core, which is a bicyclic structure known for its presence in various biologically active molecules. The sulfonyl group attached to a 4-methylphenyl moiety enhances its chemical reactivity and solubility properties, making it suitable for various applications in medicinal chemistry. The pyridine ring contributes to the compound's potential as a ligand in coordination chemistry and its ability to interact with biological targets. This compound may exhibit interesting pharmacological properties, including potential activity as an antitumor or neuroprotective agent, although specific biological activities would require further investigation. Its synthesis and characterization involve standard organic chemistry techniques, and it is important to handle it with care due to the presence of sulfonyl groups, which can influence its reactivity and stability.

Formula: C₂₁H₂₀N₂O₂S

InChI: InChI=1/C21H20N2O2S/c1-16-6-8-19(9-7-16)26(24,25)23-15-12-17-4-2-3-5-20(17)21(23)18-10-13-22-14-11-18/h2-11,13-14,21H,12,15H2,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)N1CCc2ccccc2C1c1ccncc1

Acetic acid, cyano-, potassium salt

CAS: 7062-95-5

Formula: C₃H₂KNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 123.1518

Ref: IN-DA00IC34

Potassium cyanoacetate

CAS: 7062-95-5

Potassium cyanoacetate

Purity: 97%

Molecular weight: 123.15g/mol

Ref: 54-OR45175

Potassium 2-cyanoacetate

CAS: 7062-95-5

Purity: 98%

Molecular weight: 123.1520004

Ref: 10-F695527