CAS 70622-78-5

2-methoxy-4-(2-nitrovinyl)phenyl*B-D-galactopyran

Description:

2-Methoxy-4-(2-nitrovinyl)phenyl β-D-galactopyranoside, identified by the CAS number 70622-78-5, is a chemical compound that features a phenolic structure with a methoxy group and a nitrovinyl substituent. This compound is characterized by its glycosidic linkage to β-D-galactopyranose, which contributes to its solubility and reactivity in biological systems. The presence of the nitrovinyl group suggests potential applications in organic synthesis and materials science, particularly in the development of photoresponsive or electroactive materials. The methoxy group enhances the compound's lipophilicity, potentially influencing its interaction with biological membranes. Additionally, the compound may exhibit interesting optical properties due to the conjugated system formed by the nitrovinyl and phenyl groups. Overall, 2-methoxy-4-(2-nitrovinyl)phenyl β-D-galactopyranoside represents a unique structure with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₅H₁₉NO₉

InChI: InChI=1/C15H19NO9/c1-23-10-6-8(4-5-16(21)22)2-3-9(10)24-15-14(20)13(19)12(18)11(7-17)25-15/h2-6,11-15,17-20H,7H2,1H3/b5-4-

SMILES: COc1cc(ccc1OC1C(C(C(C(CO)O1)O)O)O)/C=C\N(=O)=O

Synonyms:

• 2-methoxy-4-[(Z)-2-nitroethenyl]phenyl hexopyranoside

2-Methoxy-4-(2-nitrovinyl)phenyl β-D-galactopyranoside

CAS: 70622-78-5

Formula: C₁₅H₁₉NO₉

Molecular weight: 357.31

Ref: 7W-GC2893

[2-Methoxy-4-(2-nitrovinyl)phenyl] b-D-galactopyranoside

CAS: 70622-78-5

[2-Methoxy-4-(2-nitrovinyl)phenyl] b-D-galactopyranoside (MNVP-gal) is a chromogenic enzyme substrate that is commonly used to detect the activity of beta-galactosidase in biological samples. MNVP-gal produces a distinctive magenta color when hydrolyzed by beta-galactosidase, making it particularly useful for applications where visual detection is necessary. This substrate is also resistant to endogenous proteases, making it well-suited for use in cellular and tissue preparations.

Purity: Min. 95%

Molecular weight: 357.31 g/mol

Ref: 3D-EM06779