CAS 70627-17-7
:4-[(2,4-dichlorobenzyl)oxy]benzaldehyde
Description:
4-[(2,4-Dichlorobenzyl)oxy]benzaldehyde, with the CAS number 70627-17-7, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a dichlorobenzyl ether moiety. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the dichlorobenzyl group contributes to its chemical reactivity and may influence its biological activity. The compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic characteristics. Safety data sheets would indicate appropriate handling and storage conditions, as well as potential hazards associated with exposure. Overall, 4-[(2,4-dichlorobenzyl)oxy]benzaldehyde is a compound of interest in both research and industrial contexts, particularly in the fields of medicinal chemistry and materials science.
Formula:C14H10Cl2O2
InChI:InChI=1/C14H10Cl2O2/c15-12-4-3-11(14(16)7-12)9-18-13-5-1-10(8-17)2-6-13/h1-8H,9H2
SMILES:c1cc(ccc1C=O)OCc1ccc(cc1Cl)Cl
Synonyms:- 4-(2,4-Dichlorobenzyloxy)Benzaldehyde
- 4-(2,4-Dichloro-benzyloxy)-benzaldehyde
- Benzaldehyde, 4-[(2,4-Dichlorophenyl)Methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-[(2,4-Dichlorobenzyl)oxy]benzaldehyde
CAS:4-[(2,4-Dichlorobenzyl)oxy]benzaldehyde
Molecular weight:281.13g/mol

