CAS 70628-36-3
:2-[(1-Methylethyl)phenylamino]-2-oxoacetic acid
Description:
2-[(1-Methylethyl)phenylamino]-2-oxoacetic acid, with the CAS number 70628-36-3, is an organic compound characterized by its unique structure, which includes an amino group attached to a phenyl ring and a keto acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in acid-base reactions. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, influencing its solubility and reactivity. The compound may also display biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its stability and reactivity in different environments. Overall, 2-[(1-Methylethyl)phenylamino]-2-oxoacetic acid is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c1-8(2)12(10(13)11(14)15)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,14,15)
InChI key:InChIKey=HYHJOUPYTUBFIX-UHFFFAOYSA-N
SMILES:N(C(C(O)=O)=O)(C(C)C)C1=CC=CC=C1
Synonyms:- 2-[(1-Methylethyl)phenylamino]-2-oxoacetic acid
- Acetic Acid, 2-[(1-Methylethyl)Phenylamino]-2-Oxo-
- Acetic acid, [(1-methylethyl)phenylamino]oxo-
- [Isopropyl(phenyl)amino](oxo)acetic acid
- [Phenyl(propan-2-yl)carbamoyl]formic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Propachlor-oxalamic acid (OA) 100 µg/mL in Acetonitrile/Water
CAS:Formula:C11H13NO3Color and Shape:Single SolutionMolecular weight:207.23Propachlor OA
CAS:Controlled ProductApplications Propachlor OA is an acetanilide herbicide.
References Fuhrman, J. D., et al.: ACS Symp. Ser., 850, 256 (2003); Larsen, G. L., et al.: Xenobiotica, 30, 1153 (2000); Shoemaker, J. A., et al.: J. AOAC Int., 85, 1331 (2002)Formula:C11H13NO3Color and Shape:NeatMolecular weight:207.23

