CAS 7063-22-1

Butanoic acid, 2,2-dimethyl-3-oxo-, sodium salt (1:1)

Description:

Butanoic acid, 2,2-dimethyl-3-oxo-, sodium salt (1:1), commonly referred to as a sodium salt of a specific butanoic acid derivative, is an organic compound characterized by its carboxylic acid functional group, which is neutralized by sodium to form a salt. This compound typically exhibits properties associated with both carboxylic acids and their corresponding salts, such as solubility in water due to the ionic nature of the sodium salt. It may have applications in various fields, including pharmaceuticals, food additives, and as a biochemical reagent. The presence of the ketone group (3-oxo) in its structure suggests potential reactivity and the ability to participate in various chemical reactions, including condensation and oxidation. Additionally, the branched structure (2,2-dimethyl) may influence its physical properties, such as boiling and melting points, as well as its behavior in biological systems. Overall, this compound's characteristics make it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₆H₁₀O₃·Na

InChI: InChI=1S/C6H10O3.Na/c1-4(7)6(2,3)5(8)9;/h1-3H3,(H,8,9);

InChI key: InChIKey=BMHZEJBBJAVJMM-UHFFFAOYSA-N

SMILES: C(C(C)=O)(C(O)=O)(C)C.[Na]

Synonyms:

• Acetoacetic acid, 2,2-dimethyl-, sodium salt
• Butanoic acid, 2,2-dimethyl-3-oxo-, sodium salt (1:1)
• Butanoic acid, 2,2-dimethyl-3-oxo-, sodium salt