
CAS 7063-54-9
:1-ethyl-5-{[3-(3-methoxypropyl)-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene]methyl}-4-methyl-2-oxo-6-pyrrolidin-1-yl-1,2-dihydropyridine-3-carbonitrile
Description:
The chemical substance known as "1-ethyl-5-{[3-(3-methoxypropyl)-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene]methyl}-4-methyl-2-oxo-6-pyrrolidin-1-yl-1,2-dihydropyridine-3-carbonitrile" with the CAS number 7063-54-9 is a complex organic compound characterized by multiple functional groups and a diverse molecular structure. It features a pyrrolidine ring, a dihydropyridine moiety, and a thiazolidine derivative, indicating potential biological activity. The presence of a carbonitrile group suggests it may exhibit reactivity typical of nitriles, while the thioxo and oxo groups imply potential for tautomerism and varied reactivity. The methoxypropyl substituent adds to its lipophilicity, which may influence its solubility and permeability in biological systems. Such compounds are often investigated for their pharmacological properties, including potential roles in medicinal chemistry as enzyme inhibitors or in other therapeutic applications. Overall, the intricate structure of this compound suggests a rich chemistry that could be explored for various applications in drug development and synthesis.
Formula:C21H26N4O3S2
InChI:InChI=1/C21H26N4O3S2/c1-4-24-18(23-8-5-6-9-23)15(14(2)16(13-22)19(24)26)12-17-20(27)25(21(29)30-17)10-7-11-28-3/h12H,4-11H2,1-3H3
SMILES:CCn1c(c(C=C2C(=O)N(CCCOC)C(=S)S2)c(C)c(C#N)c1=O)N1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4-Chlorophenyl)-2-(methylamino)cyclohexanone-d6
CAS:Controlled ProductFormula:C13H10D6ClNOColor and Shape:NeatMolecular weight:228.25
