CymitQuimica logo

CAS 70631-50-4

:

1-(bromomethyl)-7-fluoronaphthalene

Description:
1-(Bromomethyl)-7-fluoronaphthalene is an organic compound characterized by its naphthalene backbone, which consists of two fused aromatic rings. The presence of a bromomethyl group (-CH2Br) at the first position and a fluorine atom at the seventh position of the naphthalene structure imparts unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromine atom, which can be replaced by various nucleophiles. The fluorine atom can influence the compound's electronic properties, making it useful in various applications, including organic synthesis and materials science. Additionally, 1-(bromomethyl)-7-fluoronaphthalene may exhibit interesting photophysical properties, making it a candidate for studies in fluorescence and photochemistry. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of halogenated groups.
Formula:C11H8BrF
InChI:InChI=1/C11H8BrF/c12-7-9-3-1-2-8-4-5-10(13)6-11(8)9/h1-6H,7H2
SMILES:c1cc2ccc(cc2c(c1)CBr)F
Synonyms:
  • Naphthalene, 1-(Bromomethyl)-7-Fluoro-
  • 1-(Bromomethyl)-7-fluoronaphthalene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.