CAS 70631-51-5

7-Fluoro-1-naphthaleneacetonitrile

Description:

7-Fluoro-1-naphthaleneacetonitrile, with the CAS number 70631-51-5, is an organic compound characterized by the presence of a naphthalene ring substituted with a fluorine atom and a nitrile group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the naphthalene structure, which contributes to its stability and potential reactivity. The fluorine substitution can influence the electronic properties of the molecule, potentially enhancing its reactivity in certain chemical reactions. As a nitrile, it contains a cyano group (-C≡N), which can participate in various chemical transformations, making it useful in synthetic organic chemistry. The compound may also exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its applications may include use as an intermediate in the synthesis of pharmaceuticals or agrochemicals, as well as in materials science. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₂H₈FN

InChI: InChI=1S/C12H8FN/c13-11-5-4-9-2-1-3-10(6-7-14)12(9)8-11/h1-5,8H,6H2

InChI key: InChIKey=BCCXBNLRWZLGFW-UHFFFAOYSA-N

SMILES: C(C#N)C=1C2=C(C=CC(F)=C2)C=CC1

Synonyms:

• 2-(7-Fluoronaphthalen-1-yl)acetonitrile
• 7-Fluoro-1-naphthaleneacetonitrile
• 1-Naphthaleneacetonitrile, 7-fluoro-