CAS 70637-05-7
:4-(1,1-Dimethylethyl)-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane
Description:
4-(1,1-Dimethylethyl)-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane, with CAS number 70637-05-7, is a bicyclic organic compound characterized by its unique structure, which includes a bicyclo[2.2.2]octane framework and three oxygen atoms incorporated into its cyclic structure. This compound features a tert-butyl group (1,1-dimethylethyl) and a phenyl group, contributing to its hydrophobic characteristics and potential for various interactions in chemical reactions. The presence of the trioxabicyclo structure suggests that it may exhibit interesting properties such as stability and potential reactivity under specific conditions. Its molecular structure may allow for applications in fields such as organic synthesis, materials science, or pharmaceuticals, where the unique arrangement of atoms can influence its reactivity and interactions with other substances. However, specific physical and chemical properties such as melting point, boiling point, solubility, and reactivity would need to be determined through experimental methods or detailed literature to fully understand its behavior in various environments.
Formula:C15H20O3
InChI:InChI=1S/C15H20O3/c1-13(2,3)14-9-16-15(17-10-14,18-11-14)12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3
InChI key:InChIKey=YXVNWLKUIGTVIH-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C12COC(OC1)(OC2)C3=CC=CC=C3
Synonyms:- 2,6,7-trioxabicyclo[2.2.2]octane, 4-(1,1-dimethylethyl)-1-phenyl-
- 4-tert-Butyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane
- 4-(1,1-Dimethylethyl)-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane
- 2,6,7-Trioxabicyclo[2.2.2]octane, 4-(1,1-dimethylethyl)-1-phenyl-
- 2,6,7-Trioxabicyclo(2.2.2)octane 4-tert-butyl-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Tert-butyl-1-phenyl-2,6,7-trioxabicyclo(2.2.2)octane
CAS:Controlled ProductFormula:C15H20O3Color and Shape:NeatMolecular weight:248.32
