CAS 7064-31-5
:5-(4-bromophenyl)isoxazole
Description:
5-(4-Bromophenyl)isoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the 4-bromophenyl group indicates that a bromine atom is substituted on a phenyl ring at the para position relative to the isoxazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. The bromine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, 5-(4-bromophenyl)isoxazole may exhibit biological activity, which has led to its investigation in medicinal chemistry for potential therapeutic applications. Its molecular structure contributes to its unique physical and chemical properties, making it of interest in both academic research and industrial applications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H6BrNO
InChI:InChI=1/C31H34N6O3S2/c1-6-14-35-27(34-15-10-11-19(2)18-34)23(20(3)24(17-32)28(35)38)16-25-29(39)36(31(41)42-25)26-21(4)33(5)37(30(26)40)22-12-8-7-9-13-22/h7-9,12-13,16,19H,6,10-11,14-15,18H2,1-5H3
SMILES:CCCn1c(c(C=C2C(=O)N(c3c(C)n(C)n(c4ccccc4)c3=O)C(=S)S2)c(C)c(C#N)c1=O)N1CCCC(C)C1
Synonyms:- 5-{[3-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene]methyl}-4-methyl-6-(3-methylpiperidin-1-yl)-2-oxo-1-propyl-1,2-dihydropyridine-3-carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-(4-Bromophenyl)isoxazole, 98%
CAS:5-(4-Bromophenyl)isoxazole is used as an active pharmaceutical ingredients. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or S
Formula:C9H6BrNOPurity:98%Molecular weight:224.065-(4-Bromophenyl)isoxazole
CAS:Formula:C9H6BrNOPurity:99%Color and Shape:SolidMolecular weight:224.05405-(4-Bromophenyl)isoxazole
CAS:Formula:C9H6BrNOPurity:95.0%Color and Shape:No data available.Molecular weight:224.0575-(4-Bromophenyl)-1,2-oxazole
CAS:5-(4-Bromophenyl)-1,2-oxazole is an isoxazole that can be synthesized for use in both organic synthesis and as a catalyst. The reaction mechanism of 5-(4-bromophenyl)-1,2-oxazole is radical and the catalytic efficiency of this compound is high. The synthesis of 5-(4-bromophenyl)-1,2-oxazole has been improved by using hydroxylamine as a reducing agent to produce clean products. The reaction yields are also efficient with a high conversion rate.
Formula:C9H6BrNOPurity:Min. 95%Molecular weight:224.05 g/mol




