
CAS 7064-40-6
:4,5-Dimethylisoxazole
Description:
4,5-Dimethylisoxazole is a heterocyclic organic compound characterized by a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. Its molecular formula is C6H9N1O1, and it features two methyl groups attached to the isoxazole ring at the 4 and 5 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its role in various chemical reactions and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 4,5-Dimethylisoxazole exhibits moderate polarity, which influences its solubility in organic solvents. Additionally, it has potential applications in medicinal chemistry due to its biological activity, including antimicrobial and anti-inflammatory properties. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4,5-Dimethylisoxazole is a versatile compound with significant relevance in both industrial and research settings.
Formula:C5H7NO
InChI:InChI=1S/C5H7NO/c1-4-3-6-7-5(4)2/h3H,1-2H3
InChI key:InChIKey=BSWGZCMLNFBDEZ-UHFFFAOYSA-N
SMILES:CC1=C(C)ON=C1
Synonyms:- 4,5-Dimethylisoxazole
- Isoxazole, 4,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.