
CAS 70644-46-1
:4-(3-Cyclohexen-1-yl)pyridine
Description:
4-(3-Cyclohexen-1-yl)pyridine, with the CAS number 70644-46-1, is an organic compound characterized by its pyridine ring substituted with a cyclohexenyl group. This compound features a six-membered cyclohexene ring, which introduces unsaturation and contributes to its reactivity and potential applications in organic synthesis. The presence of the nitrogen atom in the pyridine ring imparts basicity and can influence the compound's interaction with other chemical species. Typically, compounds like this may exhibit interesting properties such as solubility in organic solvents, moderate volatility, and potential for participation in electrophilic or nucleophilic reactions due to the electron-rich nature of the cyclohexenyl group. Additionally, the structural features may allow for various stereochemical configurations, which can affect the compound's biological activity and interactions. Overall, 4-(3-Cyclohexen-1-yl)pyridine is of interest in fields such as medicinal chemistry and materials science, where its unique structure may lead to novel applications.
Formula:C11H13N
InChI:InChI=1S/C11H13N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-2,6-10H,3-5H2
InChI key:InChIKey=USWHHVUCKNMIRS-UHFFFAOYSA-N
SMILES:C1(CCC=CC1)C=2C=CN=CC2
Synonyms:- 4-(Cyclohex-3-enyl)pyridine
- Pyridine, 4-(3-cyclohexen-1-yl)-
- 4-(3-Cyclohexen-1-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.