CAS 70648-13-4
:1,4,9-trichlorodibenzo[b,d]furan
Description:
1,4,9-Trichlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with three chlorine substituents at the 1, 4, and 9 positions. This compound is part of a larger class of chlorinated dibenzofurans, which are known for their potential environmental persistence and toxicity. It typically appears as a solid at room temperature and is insoluble in water but may dissolve in organic solvents. The presence of chlorine atoms enhances its lipophilicity, which can lead to bioaccumulation in living organisms. 1,4,9-Trichlorodibenzo[b,d]furan is of interest in environmental chemistry due to its potential formation as a byproduct in various industrial processes, particularly those involving chlorinated compounds. Its toxicological profile suggests that it may pose risks to human health and ecosystems, necessitating careful handling and assessment in environmental monitoring and regulatory frameworks.
Formula:C12H5Cl3O
InChI:InChI=1/C12H5Cl3O/c13-6-2-1-3-9-10(6)11-7(14)4-5-8(15)12(11)16-9/h1-5H
SMILES:c1cc(c2c(c1)oc1c(ccc(c21)Cl)Cl)Cl
Synonyms:- 1,4,9-Trichlorodibenzofuran
- Dibenzofuran, 1,4,9-trichloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.