CAS 70648-20-3
:1,3,4,7,9-pentachlorodibenzo[b,d]furan
Description:
1,3,4,7,9-Pentachlorodibenzo[b,d]furan is a chlorinated aromatic compound known for its complex structure and environmental persistence. It features a dibenzo-furan backbone with five chlorine atoms substituted at specific positions, which significantly influences its chemical properties and biological activity. This compound is typically characterized by its low solubility in water and higher solubility in organic solvents, making it hydrophobic. It is known to exhibit potential toxicity and environmental hazards, as chlorinated compounds can bioaccumulate and persist in ecosystems. The presence of multiple chlorine atoms contributes to its stability and resistance to degradation. Additionally, 1,3,4,7,9-pentachlorodibenzo[b,d]furan is often studied in the context of environmental monitoring and risk assessment due to its potential as a pollutant. Its synthesis and use are regulated in many jurisdictions due to concerns over its impact on human health and the environment. Overall, this compound exemplifies the challenges associated with managing chlorinated organic pollutants.
Formula:C12H3Cl5O
InChI:InChI=1/C12H3Cl5O/c13-4-1-5(14)9-8(2-4)18-12-10(9)6(15)3-7(16)11(12)17/h1-3H
SMILES:c1c(cc2c(c1Cl)c1c(cc(c(c1o2)Cl)Cl)Cl)Cl
Synonyms:- Dibenzofuran, 1,3,4,7,9-pentachloro
- 1,3,4,7,9-Pentachlorodibenzo[b,d]furan
- 1,3,4,7,9-PENTACHLORODIBENZOFURAN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.