CymitQuimica logo

CAS 70648-87-2

:

{[2-oxo-2-(phenylamino)ethyl]sulfanyl}acetic acid

Description:
The chemical substance known as {[2-oxo-2-(phenylamino)ethyl]sulfanyl}acetic acid, with the CAS number 70648-87-2, is characterized by its unique structure that includes a sulfanyl group and an acetic acid moiety. This compound features a phenylamino group, which contributes to its potential biological activity and interaction with various biological targets. The presence of the oxo group indicates that it may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The sulfanyl group enhances its reactivity and may influence its solubility and stability in different solvents. This compound may exhibit properties typical of both amino acids and thiols, potentially making it useful in medicinal chemistry and as a building block in organic synthesis. Its specific applications and biological activities would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, {[2-oxo-2-(phenylamino)ethyl]sulfanyl}acetic acid represents a versatile chemical entity with potential implications in various fields of research.
Formula:C10H11NO3S
InChI:InChI=1/C10H11NO3S/c12-9(6-15-7-10(13)14)11-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)(H,13,14)
SMILES:c1ccc(cc1)N=C(CSCC(=O)O)O
Synonyms:
  • [(2-Anilino-2-Oxoethyl)Sulfanyl]Acetic Acid
  • 2-{[(Phenylcarbamoyl)Methyl]Sulfanyl}Acetic Acid
  • Acetic Acid, 2-[[2-Oxo-2-(Phenylamino)Ethyl]Thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.