CymitQuimica logo

CAS 7065-23-8

:

ethyl 2-quinoxalinecarboxylate

Description:
Ethyl 2-quinoxalinecarboxylate, with the CAS number 7065-23-8, is an organic compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its role as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Ethyl 2-quinoxalinecarboxylate exhibits moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic nature. The compound may participate in various chemical reactions, including esterification and cyclization, making it valuable in synthetic chemistry. Additionally, it may exhibit biological activity, although specific pharmacological properties would require further investigation. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C25H34N4O3S2
InChI:InChI=1/C25H34N4O3S2/c1-7-8-9-28-22(27-13-16(4)32-17(5)14-27)19(18(6)20(11-26)23(28)30)10-21-24(31)29(12-15(2)3)25(33)34-21/h10,15-17H,7-9,12-14H2,1-6H3
Synonyms:
  • ethyl quinoxaline-2-carboxylate
  • 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-{[3-(2-methylpropyl)-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene]methyl}-2-oxo-1,2-dihydropyridine-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.