CAS 70653-29-1

1-[(4-Methoxyphenyl)methyl] 2-[4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]propanedioate

Description:

1-[(4-Methoxyphenyl)methyl] 2-[4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]propanedioate, with the CAS number 70653-29-1, is a chemical compound characterized by its complex structure, which includes a propanedioate backbone and two aromatic rings. The presence of a methoxy group on one of the phenyl rings enhances its lipophilicity, potentially influencing its solubility and reactivity. The tetrahydro-2H-pyran moiety introduces a cyclic ether component, which can affect the compound's stability and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its properties could be explored through various analytical techniques such as NMR, IR spectroscopy, and mass spectrometry. Overall, the unique combination of functional groups and structural elements in this compound suggests potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological activity and chemical behavior.

Formula: C₂₂H₂₄O₇

InChI: InChI=1S/C22H24O7/c1-26-17-9-5-15(6-10-17)14-28-22(25)20(21(23)24)16-7-11-18(12-8-16)29-19-4-2-3-13-27-19/h5-12,19-20H,2-4,13-14H2,1H3,(H,23,24)

InChI key: InChIKey=WSXXVZZKAKUJEO-UHFFFAOYSA-N

SMILES: C(C(OCC1=CC=C(OC)C=C1)=O)(C(O)=O)C2=CC=C(OC3CCCCO3)C=C2

Synonyms:

• 1-[(4-Methoxyphenyl)methyl] 2-[4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]propanedioate
• Propanedioic acid, [4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]-, mono[(4-methoxyphenyl)methyl] ester
• Propanedioic acid, 2-[4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]-, 1-[(4-methoxyphenyl)methyl] ester

Latamoxef Impurity 72

CAS: 70653-29-1

Formula: C₂₂H₂₄O₇

Molecular weight: 400.43

Ref: 4Z-L-102073