CymitQuimica logo

CAS 70656-87-0

:

5-methyl-3,4-dihydro-2H-1,4-benzodiazepin-2-one

Description:
5-Methyl-3,4-dihydro-2H-1,4-benzodiazepin-2-one, with the CAS number 70656-87-0, is a chemical compound belonging to the benzodiazepine class, which is characterized by a fused benzene and diazepine ring structure. This compound features a methyl group at the 5-position and a carbonyl group at the 2-position, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. The presence of the methyl group can influence its pharmacological activity, potentially affecting its binding affinity to GABA receptors, which are crucial for its sedative and anxiolytic effects. The compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities and safety profiles would require further investigation. As with many benzodiazepines, it is essential to handle this compound with care due to its potential effects on the central nervous system.
Formula:C10H10N2O
InChI:InChI=1/C10H10N2O/c1-7-8-4-2-3-5-9(8)12-10(13)6-11-7/h2-5,11H,6H2,1H3
SMILES:CC1=c2ccccc2=NC(=O)CN1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.