
CAS 7066-13-9
:2-Amino-1-naphthalenecarbonitrile
Description:
2-Amino-1-naphthalenecarbonitrile, with the CAS number 7066-13-9, is an organic compound characterized by its naphthalene structure substituted with an amino group and a nitrile group. This compound typically appears as a solid and is known for its aromatic properties due to the naphthalene ring, which contributes to its stability and potential reactivity. The presence of the amino group (-NH2) makes it a basic compound, while the nitrile group (-C≡N) introduces a polar functional group that can participate in various chemical reactions, such as nucleophilic additions. 2-Amino-1-naphthalenecarbonitrile may be used in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its solubility can vary depending on the solvent, and it may exhibit fluorescence properties, making it useful in certain analytical applications. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C11H8N2
InChI:InChI=1S/C11H8N2/c12-7-10-9-4-2-1-3-8(9)5-6-11(10)13/h1-6H,13H2
InChI key:InChIKey=QUXTXQGNFNNFGN-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(C=CC1N)C=CC=C2
Synonyms:- 2-Amino-1-naphthalenecarbonitrile
- NSC 43418
- 1-Naphthonitrile, 2-amino-
- 2-Aminonaphthalene-1-carbonitrile
- 1-Naphthalenecarbonitrile, 2-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.