CymitQuimica logo

CAS 7066-36-6

:

2,3-difluoroquinoxaline

Description:
2,3-Difluoroquinoxaline is a heterocyclic compound characterized by the presence of a quinoxaline ring, which consists of two fused aromatic rings containing nitrogen atoms. The specific substitution of fluorine atoms at the 2 and 3 positions of the quinoxaline structure significantly influences its chemical properties and reactivity. This compound is typically a pale yellow to light brown solid, exhibiting moderate solubility in organic solvents. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity against various targets. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, making it an attractive candidate for drug design. Additionally, 2,3-difluoroquinoxaline may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the fluorine substituents. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C8H4F2N2
InChI:InChI=1/C8H4F2N2/c9-7-8(10)12-6-4-2-1-3-5(6)11-7/h1-4H
SMILES:c1ccc2c(c1)nc(c(F)n2)F
Synonyms:
  • Quinoxaline, 2,3-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.