CAS 70661-80-2

2H-Pyrido[2,3-e]-1,2,4-thiadiazin-3(4H)-one, 1,1-dioxide

Description:

2H-Pyrido[2,3-e]-1,2,4-thiadiazin-3(4H)-one, 1,1-dioxide, commonly referred to by its CAS number 70661-80-2, is a heterocyclic compound featuring a pyridine ring fused with a thiadiazine structure. This compound is characterized by the presence of a sulfur atom and a nitrogen atom within its ring system, contributing to its unique chemical properties. It typically exhibits a pale yellow to white crystalline appearance and is soluble in polar solvents. The presence of the 1,1-dioxide functional group indicates that it has two oxygen atoms double-bonded to the sulfur atom, which can influence its reactivity and potential applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, although specific biological properties would require further investigation. Overall, 2H-Pyrido[2,3-e]-1,2,4-thiadiazin-3(4H)-one, 1,1-dioxide is a compound of interest in various fields, including pharmaceuticals and materials science.

Formula: C₆H₅N₃O₃S

InChI: InChI=1S/C6H5N3O3S/c10-6-8-5-4(2-1-3-7-5)13(11,12)9-6/h1-3H,(H2,7,8,9,10)

InChI key: InChIKey=REIOLZVTBJXGNA-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(NC(=O)N1)=NC=CC2

Synonyms:

• 2H-Pyrido[2,3-e]-1,2,4-thiadiazin-3(4H)-one, 1,1-dioxide