CAS 70672-82-1

5-bromo-3-methyl-1,3-benzoxazol-2(3H)-one

Description:

5-Bromo-3-methyl-1,3-benzoxazol-2(3H)-one is a heterocyclic organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. The presence of a bromine atom at the 5-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic nature. It is often used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The compound's reactivity can be influenced by the electron-withdrawing effects of the bromine atom, which can affect its electrophilic and nucleophilic properties. Additionally, the presence of the oxazole ring may impart biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-bromo-3-methyl-1,3-benzoxazol-2(3H)-one is a valuable compound in organic synthesis and research.

Formula: C₈H₆BrNO₂

InChI: InChI=1/C8H6BrNO2/c1-10-6-4-5(9)2-3-7(6)12-8(10)11/h2-4H,1H3

SMILES: Cn1c2cc(ccc2oc1=O)Br

5-Bromo-3-Methylbenzo[d]Oxazol-2(3H)-One

CAS: 70672-82-1

Formula: C₈H₆BrNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.0427

Ref: IN-DA01E6KM

5-Bromo-3-methylbenzo[d]oxazol-2(3H)-one

CAS: 70672-82-1

5-Bromo-3-methylbenzo[d]oxazol-2(3H)-one

Purity: 98%

Molecular weight: 228.04g/mol

Ref: 54-OR1059468

5-BROMO-3-METHYLBENZO[D]OXAZOL-2(3H)-ONE

CAS: 70672-82-1

Formula: C₈H₆BrNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.045

Ref: 10-F499212

5-Bromo-3-methylbenzo[D]oxazol-2(3H)-one

CAS: 70672-82-1

Versatile small molecule scaffold

Formula: C₈H₆BrNO₂

Purity: Min. 95%

Molecular weight: 228.04 g/mol

Ref: 3D-VCA67282