CymitQuimica logo

CAS 706748-53-0

:

Boronic acid,(1-methyl-4-piperidinyl)- (9CI)

Description:
Boronic acid, (1-methyl-4-piperidinyl)-, also known by its CAS number 706748-53-0, is an organic compound characterized by the presence of a boronic acid functional group attached to a piperidine ring. This compound typically exhibits properties associated with both boron and nitrogen functionalities, making it useful in various chemical applications, particularly in medicinal chemistry and organic synthesis. The piperidine moiety contributes to its basicity and potential for forming hydrogen bonds, enhancing its reactivity and solubility in polar solvents. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is a key feature in applications such as drug design and materials science. Additionally, this compound may exhibit biological activity, making it a candidate for further research in pharmacology. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in laboratory settings.
Formula:C6H14BNO2
InChI:InChI=1S/C6H14BNO2/c1-8-4-2-6(3-5-8)7(9)10/h6,9-10H,2-5H2,1H3
InChI key:HFHBLPSKMYOFOB-UHFFFAOYSA-N
SMILES:B(C1CCN(CC1)C)(O)O
Synonyms:
  • Boronic acid, 4-piperidinyl-
Found 4 products.