CAS 70677-78-0
:dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate
Description:
Dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate, with the CAS number 70677-78-0, is a chemical compound that belongs to the class of dihydropyridines, which are known for their role in various biological activities, particularly as calcium channel blockers. This compound features a dihydropyridine ring substituted with two methyl groups at the 2 and 6 positions, a phenyl group at the 4 position, and two ester functional groups at the 3 and 5 positions, contributing to its potential reactivity and solubility characteristics. The presence of the dimethyl ester groups enhances its lipophilicity, which can influence its pharmacokinetic properties. Dihydropyridines are often studied for their cardiovascular effects, and this compound may exhibit similar properties, making it of interest in medicinal chemistry. Its structural complexity and functional groups suggest potential applications in drug development, particularly in the design of agents targeting calcium channels or related pathways.
Formula:C17H19NO4
InChI:InChI=1/C17H19NO4/c1-10-13(16(19)21-3)15(12-8-6-5-7-9-12)14(11(2)18-10)17(20)22-4/h5-9,15,18H,1-4H3
SMILES:CC1=C(C(c2ccccc2)C(=C(C)N1)C(=O)OC)C(=O)OC
Synonyms:- 1,4-Dihydro-2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylic acid dimethyl ester
- 2,6-Dimethyl-3,5-dicarbomethoxy-4-phenyl-1,4-dihydropyridine
- 2,6-Dimethyl-4-phenyl-1,4-dihydro-pyridine-3,5-dicarboxylic acid dimethyl ester
- 3,5-Pyridinedicarboxylic Acid, 1,4-Dihydro-2,6-Dimethyl-4-Phenyl-, Dimethyl Ester
- Dimethyl 1,4-dihydro-2,6-dimethyl-4-phenyl-3,5-pyridinedicarboxylate
- Dimethyl 4-phenyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
- Methyl (4-phenyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate)
- Dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate
CAS:Dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate is a radioligand that binds to calcium channels. It is used as a radioligand in binding studies to determine the affinity of various drugs for specific types of calcium channels. Dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine 3,5 dicarboxylate has been shown to bind specifically to a particular class of calcium channel antagonists (i.e., monosubstituted) and can be used as a pharmacological probe for the study of these compounds.Formula:C17H19NO4Purity:Min. 95%Molecular weight:301.34 g/molRef: 3D-VCA67778
Discontinued product

