CAS 706789-01-7

5-Fluoro-3-methyl-1H-indole-2-methanol

Description:

5-Fluoro-3-methyl-1H-indole-2-methanol is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position and a methyl group at the 3-position contributes to its unique properties and reactivity. The hydroxymethyl group at the 2-position enhances its potential for hydrogen bonding and may influence its solubility and biological activity. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of new therapeutic agents. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, the presence of the fluorine atom can enhance metabolic stability and lipophilicity, which are important factors in drug design. Overall, 5-Fluoro-3-methyl-1H-indole-2-methanol exhibits characteristics that make it a valuable compound for further investigation in chemical and pharmaceutical research.

Formula: C₁₀H₁₀FNO

InChI: InChI=1S/C10H10FNO/c1-6-8-4-7(11)2-3-9(8)12-10(6)5-13/h2-4,12-13H,5H2,1H3

InChI key: InChIKey=YLRLBPLIQUGFEP-UHFFFAOYSA-N

SMILES: CC=1C=2C(NC1CO)=CC=C(F)C2

Synonyms:

• 5-Fluoro-3-methyl-1H-indole-2-methanol
• 1H-Indole-2-methanol, 5-fluoro-3-methyl-