CymitQuimica logo

CAS 706789-06-2

:

2-Chloro-4-oxazolemethanol

Description:
2-Chloro-4-oxazolemethanol is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a chlorine atom at the 2-position and a hydroxymethyl group at the 4-position contributes to its unique reactivity and potential applications. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for many oxazole derivatives. Its reactivity can be attributed to the electrophilic nature of the chlorine atom, making it useful in various synthetic applications, including medicinal chemistry and material science. The compound may exhibit biological activity, although specific pharmacological properties would depend on further studies. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 2-Chloro-4-oxazolemethanol represents a versatile building block in organic synthesis and research.
Formula:C4H4ClNO2
InChI:InChI=1S/C4H4ClNO2/c5-4-6-3(1-7)2-8-4/h2,7H,1H2
InChI key:InChIKey=HMMQMGKNKSNKCV-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(Cl)OC1
Synonyms:
  • 2-Chloro-4-oxazolemethanol
  • 4-Oxazolemethanol, 2-chloro-
  • (2-Chloro-1,3-oxazol-4-yl)methanol
  • (2-Chlorooxazol-4-yl)methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.