CAS 706789-07-3

2-Chlorooxazole-4-carboxylic acid

Description:

2-Chlorooxazole-4-carboxylic acid is a heterocyclic organic compound characterized by the presence of both a chloro substituent and a carboxylic acid functional group on an oxazole ring. The oxazole ring consists of a five-membered aromatic structure containing both nitrogen and oxygen atoms, which contributes to its unique chemical properties. The presence of the chlorine atom typically enhances the compound's reactivity, making it useful in various synthetic applications. The carboxylic acid group imparts acidic characteristics, allowing for potential interactions in biological systems or as a precursor in chemical synthesis. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and conditions, which is crucial for its application in different chemical reactions. Overall, 2-Chlorooxazole-4-carboxylic acid is a versatile compound with potential uses in medicinal chemistry and organic synthesis, owing to its functional groups and structural features.

Formula: C₄H₂ClNO₃

InChI: InChI=1/C4H2ClNO3/c5-4-6-2(1-9-4)3(7)8/h1H,(H,7,8)

SMILES: c1c(C(=O)O)nc(Cl)o1

2-Chlorooxazole-4-carboxylic acid

CAS: 706789-07-3

Formula: C₄H₂ClNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.5166

Ref: IN-DA005SUN

2-Chlorooxazole-4-carboxylic acid

CAS: 706789-07-3

2-Chlorooxazole-4-carboxylic acid

Purity: 95%

Molecular weight: 147.52g/mol

Ref: 54-OR94344

2-Chlorooxazole-4-carboxylic acid

CAS: 706789-07-3

Formula: C₄H₂ClNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.51

Ref: 10-F220223

2-Chlorooxazole-4-carboxylic Acid

Controlled Product

CAS: 706789-07-3

Formula: C₄H₂ClNO₃

Color and Shape: Neat

Molecular weight: 147.517

Ref: TR-C374895

2-Chlorooxazole-4-carboxylicacid

CAS: 706789-07-3

2-Chlorooxazole-4-carboxylic acid is a synthetic compound belonging to the group of long-chain aliphatic carboxylic acids. It is an ester that can be synthesized by the reaction of toluene with 2,4-dichlorooxazole. The stereochemical configuration of this molecule is unknown. The synthesis of this compound has been reported in marine invertebrates and plants, including Mycalolide from the marine sponge Mycale sp.

Formula: C₄H₂ClNO₃

Purity: Min. 95%

Molecular weight: 147.52 g/mol

Ref: 3D-FC150117