CymitQuimica logo

CAS 706789-08-4

:

4-(Bromomethyl)-2-chlorooxazole

Description:
4-(Bromomethyl)-2-chlorooxazole is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on an oxazole ring. The oxazole moiety consists of a five-membered ring containing both nitrogen and oxygen, contributing to its reactivity and potential applications in organic synthesis. The bromomethyl group introduces a reactive site, making it useful for further chemical modifications or as an intermediate in various synthetic pathways. The chlorine atom enhances the compound's electrophilic character, which can facilitate nucleophilic substitution reactions. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science, due to its unique structural features. Its properties, such as solubility, stability, and reactivity, can vary depending on the solvent and conditions used in experiments. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.
Formula:C4H3BrClNO
InChI:InChI=1S/C4H3BrClNO/c5-1-3-2-8-4(6)7-3/h2H,1H2
InChI key:InChIKey=LSGZUOHCHISPLI-UHFFFAOYSA-N
SMILES:C(Br)C=1N=C(Cl)OC1
Synonyms:
  • Oxazole, 4-(bromomethyl)-2-chloro-
  • 4-(Bromomethyl)-2-chlorooxazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.