CAS 70681-20-8
:(+-)-salsolinol hydrochloride
Description:
(±)-Salsolinol hydrochloride is a chemical compound that belongs to the class of alkaloids, specifically a derivative of the amino alcohols. It is characterized by its chiral nature, possessing two enantiomers, which can exhibit different biological activities. This compound is often studied for its potential neuropharmacological effects, particularly in relation to dopamine and its role in the central nervous system. The hydrochloride salt form enhances its solubility in water, making it more suitable for various applications in research and pharmacology. (±)-Salsolinol is known to interact with neurotransmitter systems and has been investigated for its implications in neurodegenerative diseases and addiction. Its molecular structure includes a phenolic hydroxyl group and a side chain that contributes to its biological activity. As with many chemical substances, handling (±)-salsolinol hydrochloride requires caution due to its potential effects on health, and it should be used in accordance with safety guidelines in laboratory settings.
Formula:C10H14ClNO2
InChI:InChI=1/C10H13NO2.ClH/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6;/h4-6,11-13H,2-3H2,1H3;1H
SMILES:CC1c2cc(c(cc2CCN1)O)O.Cl
Synonyms:- 6,7-Dihydroxy-1-Methyl-1,2,3,4-Tetrahydroisoquinolinium Chloride
- ()-Salsolinol, Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(+/-)-Salsolinol Hydrochloride
CAS:(+/-)-Salsolinol hydrochloride is a full Gi protein agonist of the μ-opioid receptor (μOR).Formula:C10H14ClNO2Color and Shape:SolidMolecular weight:215.68
