CAS 706819-85-4

5-Ethoxy-1-phenyl-1H-pyrazole-4-carboxylic acid

Description:

5-Ethoxy-1-phenyl-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethoxy group and a phenyl group, contributing to its unique chemical properties and potential biological activities. The carboxylic acid functional group enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification and amidation. The presence of the phenyl group may also influence its interaction with biological targets, making it of interest in medicinal chemistry. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents. Its molecular structure allows for various modifications, which can lead to derivatives with enhanced efficacy or selectivity. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₂N₂O₃

InChI: InChI=1S/C12H12N2O3/c1-2-17-11-10(12(15)16)8-13-14(11)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,15,16)

InChI key: InChIKey=YKPDDKHLNAMBOS-UHFFFAOYSA-N

SMILES: O(CC)C=1N(N=CC1C(O)=O)C2=CC=CC=C2

Synonyms:

• 5-Ethoxy-1-phenyl-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 5-ethoxy-1-phenyl-

5-Ethoxy-1-phenyl-1H-pyrazole-4-carboxylic acid

CAS: 706819-85-4

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 232.23 g/mol

Ref: 3D-GDB81985