
CAS 706820-97-5
:Methyl 3-formyl-4-[(2-methoxyethoxy)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetate
Description:
Methyl 3-formyl-4-[(2-methoxyethoxy)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetate, identified by its CAS number 706820-97-5, is a complex organic compound characterized by its multifunctional structure. It features a benzene ring substituted with various functional groups, including a formyl group and an ester group, which contribute to its reactivity and potential applications in organic synthesis. The presence of a boron-containing moiety, specifically a dioxaborolane, suggests potential utility in boron chemistry, possibly for applications in catalysis or as a building block in organic synthesis. The methoxyethoxy substituent enhances its solubility in organic solvents, making it suitable for various chemical reactions. This compound may exhibit interesting properties such as fluorescence or specific reactivity due to its unique structural features. Overall, its intricate design positions it as a valuable candidate for research in medicinal chemistry, materials science, or as an intermediate in the synthesis of more complex molecules.
Formula:C20H29BO8
InChI:InChI=1S/C20H29BO8/c1-19(2)20(3,4)29-21(28-19)16-10-14(11-17(23)25-6)9-15(12-22)18(16)27-13-26-8-7-24-5/h9-10,12H,7-8,11,13H2,1-6H3
InChI key:InChIKey=DCIFDZJXJVCIAD-UHFFFAOYSA-N
SMILES:O(COCCOC)C1=C(C=C(CC(OC)=O)C=C1C=O)B2OC(C)(C)C(C)(C)O2
Synonyms:- Methyl 2-[3-formyl-4-(2-methoxyethoxymethoxy)-5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)phenyl]acetate
- Methyl 3-formyl-4-[(2-methoxyethoxy)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetate
- Benzeneacetic acid, 3-formyl-4-[(2-methoxyethoxy)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzeneacetic acid, 3-formyl-4-[(2-methoxyethoxy)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester
CAS:Formula:C20H29BO8Molecular weight:408.2505
