CAS 706823-11-2
:N-(cyclohexylmethyl)pentan-2-amine
Description:
N-(cyclohexylmethyl)pentan-2-amine, identified by its CAS number 706823-11-2, is an organic compound characterized by its amine functional group and a branched alkyl chain. This substance features a pentane backbone with a cyclohexylmethyl substituent at the nitrogen atom, which contributes to its unique structural and chemical properties. The presence of the amine group indicates that it can participate in hydrogen bonding, influencing its solubility in polar solvents and its reactivity in various chemical reactions. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The cyclohexyl group can impart hydrophobic characteristics, affecting the compound's interaction with biological membranes. Additionally, the compound's molecular structure suggests potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. As with many amines, it may also exhibit basic properties, allowing it to act as a proton acceptor in chemical reactions. Safety and handling precautions should be observed due to the potential for toxicity associated with amines.
Formula:C12H25N
InChI:InChI=1/C12H25N/c1-3-7-11(2)13-10-12-8-5-4-6-9-12/h11-13H,3-10H2,1-2H3
SMILES:CCCC(C)NCC1CCCCC1
Synonyms:- CHEMBRDG-BB 4024867
- Cyclohexanemethanamine, N-(1-methylbutyl)-
- (CYCLOHEXYLMETHYL)(1-METHYLBUTYL)AMINE
- UKRORGSYN-BB BBV-122845
- (cyclohexylmethyl)(1-methylbutyl)amine(SALTDATA: HCl)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.