CAS 70694-08-5

Capsimycin

Description:

Capsimycin, with the CAS number 70694-08-5, is a chemical compound that belongs to the class of natural products known as antibiotics. It is primarily derived from the fermentation of certain strains of bacteria, particularly those in the genus Streptomyces. Capsimycin exhibits notable antibacterial properties, making it of interest in the field of medicinal chemistry and pharmacology. The compound is characterized by its unique molecular structure, which includes specific functional groups that contribute to its biological activity. Its mechanism of action typically involves inhibiting bacterial protein synthesis, thereby impeding the growth and reproduction of susceptible bacterial strains. Additionally, capsimycin has been studied for its potential applications in treating various infections, although its clinical use may be limited by factors such as resistance development and toxicity. Overall, capsimycin represents a significant area of research in the quest for effective antimicrobial agents.

Formula: C₃₀H₄₀N₂O₆

InChI: InChI=1S/C30H40N2O6/c1-14-12-18-19-13-16-9-10-21(33)26-27(35)20(32-30(26)36)7-5-11-31-22(34)8-4-6-17(16)24(19)28-29(38-28)25(18)23(14)15(2)37-3/h4,8-10,14-20,23-25,28-29,35H,5-7,11-13H2,1-3H3,(H,31,34)(H,32,36)/b8-4-,10-9+/t14-,15-,16-,17+,18-,19-,20+,23+,24-,25-,28+,29-/m1/s1

InChI key: InChIKey=NWWXWYOOJBNPFS-QWGRZAJISA-N

SMILES: [C@@H](OC)(C)[C@]1([C@@]2([C@@]3([C@]([C@]4([C@@]([C@]2(C[C@H]1C)[H])(C[C@@]/5([C@@]4(C/C=C\C(=O)NCCC[C@]6(C(O)=C(C(=O)\C=C5)C(=O)N6)[H])[H])[H])[H])[H])(O3)[H])[H])[H])[H]

Synonyms:

• Antibiotic N 461
• Capsimycin

Capsimycin

CAS: 70694-08-5

Capsimycin

Purity: By hplc: 75.78% (Typical Value in Batch COA)

Color and Shape: brownish amorphous solid

Molecular weight: 524.65g/mol

Ref: 54-BIBR1142

Capsimycin

CAS: 70694-08-5

Capsimycin is an antibiotic product, which is derived from the bacterium Streptomyces. This compound is part of a class of natural products isolated from soil-dwelling actinomycetes, known for their ability to produce a wide array of bioactive molecules. The mode of action of Capsimycin involves the inhibition of cell wall biosynthesis in susceptible bacterial strains. This specific mechanism disrupts the integrity of the bacterial cell wall, ultimately leading to cell lysis and death, making Capsimycin effective against a variety of Gram-positive bacteria.

Formula: C₃₀H₄₀N₂O₆

Purity: Min. 95%

Molecular weight: 524.60 g/mol

Ref: 3D-VCA69408