CAS 70695-02-2
:Nargenicin
Description:
Nargenicin is a naturally occurring antibiotic compound classified as a macrolide, primarily produced by certain strains of the bacterium *Micromonospora*. It exhibits antibacterial properties, particularly against Gram-positive bacteria, making it of interest in the field of medicinal chemistry and pharmacology. The structure of nargenicin features a large lactone ring, which is characteristic of macrolides, and it contains multiple functional groups that contribute to its biological activity. Nargenicin has been studied for its potential applications in treating infections, especially those caused by resistant bacterial strains. Its mechanism of action typically involves inhibition of protein synthesis in bacteria, which is a common feature among macrolide antibiotics. Additionally, research into nargenicin may explore its pharmacokinetics, toxicity, and potential therapeutic uses, particularly in the context of antibiotic resistance. As with many natural products, the extraction and synthesis of nargenicin can present challenges, but its unique properties continue to make it a subject of scientific interest.
Formula:C28H37NO8
InChI:InChI=1S/C28H37NO8/c1-13-11-14(2)28-17(12-20(34-5)27(33)35-23(13)16(4)30)8-9-18-21(28)22(31)15(3)24(25(18)37-28)36-26(32)19-7-6-10-29-19/h6-11,13,15-18,20-25,29-31H,12H2,1-5H3/b14-11+/t13-,15-,16-,17-,18-,20+,21+,22-,23+,24-,25-,28+/m1/s1
InChI key:InChIKey=YEUSSARNQQYBKH-SIMZXIQRSA-N
SMILES:C/C=1/[C@]23[C@]4([C@]([C@@H](O2)[C@H](OC(=O)C5=CC=CN5)[C@H](C)[C@H]4O)(C=C[C@@]3(C[C@H](OC)C(=O)O[C@]([C@@H](C)O)([C@H](C)/C1)[H])[H])[H])[H]
Synonyms:- 1H-Pyrrole-2-carboxylic acid, (1E,3R,4S,7S,8aS,10aR,11R,12R,13R,14R,14aS,14bS)-3,4,6,7,8,8a,10a,11,12,13,14,14a-dodecahydro-14-hydroxy-4-[(1R)-1-hydroxyethyl]-7-methoxy-1,3,13-trimethyl-6-oxo-11,14b-epoxy-14bH-naphth[2,1-e]oxecin-12-yl ester
- 1H-Pyrrole-2-carboxylic acid, 3,4,6,7,8,8a,10a,11,12,13,14,14a-decahydro-14-hydroxy-4-(1-hydroxyethyl)-7-methoxy-1,3,13-trimethyl-6-oxo-11,14b-epoxy-14bH-naphth[2,1-e]oxecin-12-yl ester, [3R-[1E,3R*,4S*(R*),7S*,8aS*,10aR*,11R*,12R*,13R*,14R*,14aS*,14bS*]]-
- 70695-02-2
- Antibiotic 47444
- Cp 47444
- NSC 355066
- Nargenicin
- Nargenicin A1
- Nargenicin A<sub>1</sub>
- Nodusmicin, 9-(1H-pyrrole-2-carboxylate)
- Stereoisomer of 3,4,6,7,8,8a,10a,11,12,13,14,14a-dodecahydro-14-hydroxy-4-(1-hydroxyethyl)-7-methoxy-1,3,13-trimethyl-6-oxo-11,14b-epoxy-14bH-naphth[2,1-e]oxecin-12-yl 1H-pyrrole-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Nargenicin
CAS:Nargenicin: a macrolide antibiotic effective against S. aureus, MRSA, M. luteus; inhibits bacterial DnaE and reduces inflammation and leukemia cell growth.Formula:C28H37NO8Color and Shape:SolidMolecular weight:515.6

