CAS 707-34-6
:1,3,5-tribromoadamantane
Description:
1,3,5-Tribromoadamantane is a brominated derivative of adamantane, characterized by the presence of three bromine atoms attached to the 1, 3, and 5 positions of the adamantane framework. This compound typically appears as a white crystalline solid and is known for its stability due to the rigid, cage-like structure of the adamantane core. The introduction of bromine atoms enhances its reactivity, making it useful in various chemical applications, including as a potential intermediate in organic synthesis and in the development of materials with specific properties. The presence of bromine also influences its solubility and polarity, affecting its interactions with other substances. Additionally, 1,3,5-tribromoadamantane may exhibit interesting biological activities, which have been the subject of research in medicinal chemistry. Safety considerations should be taken into account when handling this compound, as brominated compounds can pose environmental and health risks. Overall, 1,3,5-tribromoadamantane is a notable compound in the field of organic chemistry due to its unique structure and properties.
Formula:C10H13Br3
InChI:InChI=1S/C10H13Br3/c11-8-1-7-2-9(12,4-8)6-10(13,3-7)5-8/h7H,1-6H2
SMILES:C1C2CC3(CC1(CC(C2)(C3)Br)Br)Br
Synonyms:- Tricyclo[3.3.1.13,7]Decane, 1,3,5-Tribromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1,3,5-Tribromoadamantane
CAS:Formula:C10H13Br3Purity:98%Color and Shape:SolidMolecular weight:372.92221,3,5-Tribromo Adamantane
CAS:Formula:C10H13Br3Color and Shape:White To Off-White SolidMolecular weight:372.931,3,5-Tribromoadamantane
CAS:1,3,5-Tribromoadamantane is a molecule that contains a bromine atom. It has been shown to react with solvents and deforms. The kinetics of the reaction have been studied using dipole measurements. This compound reacts with lithium metal in an acidic environment and undergoes ring-opening reactions with halogens and aluminium. 1,3,5-Tribromoadamantane can be used as a substrate molecule for chromatography experiments. The stereogenic center of this molecule is thermodynamically unstable due to its electron withdrawing properties.
Formula:C10H13Br3Purity:Min. 95%Color and Shape:PowderMolecular weight:372.92 g/mol1,3,5-Tribromoadamantane
CAS:Formula:C10H13Br3Purity:95%Color and Shape:SolidMolecular weight:372.9261,3,5-Tribromoadamantane
CAS:Controlled ProductFormula:C10H13Br3Color and Shape:NeatMolecular weight:372.922






