CAS 707-36-8: 1-Chloro-3,5-dimethyladamantane
Description:1-Chloro-3,5-dimethyladamantane, with the CAS number 707-36-8, is a chemical compound belonging to the adamantane family, characterized by its unique cage-like structure. This compound features a chlorine atom substituted at the 1-position and two methyl groups at the 3 and 5 positions of the adamantane framework. It is a colorless to pale yellow solid at room temperature, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water. The presence of the chlorine atom introduces polar characteristics, influencing its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound may exhibit interesting biological activities, making it a subject of research in pharmacology. Its stability is generally high due to the robust nature of the adamantane structure, which can withstand various chemical conditions. Overall, 1-Chloro-3,5-dimethyladamantane is a notable compound in the field of organic chemistry, with potential implications in drug development and material science.
Formula:C12H19Cl
InChI:InChI=1S/C12H19Cl/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3
InChI key:InChIKey=PXDRFQZLDWZHPX-UHFFFAOYSA-N
SMILES:ClC12CC3CC(C)(C1)CC(C)(C3)C2
- Synonyms:
- 1,3-Dimethyl-5-chloroadamantane
- 1-Chloro-3,5-Dimethyltricyclo[3.3.1.1~3,7~]Decane
- 1-Chloro-3,5-dimethyladamantane
- 1-Chloro-3,5-dimethyltricyclo[3.3.1.1<sup>3,7</sup>]decane
- 3-Chloro-1,5-dimethyl-adamantane
- Adamantane, 1-chloro-3,5-dimethyl-
- Tricyclo[3.3.1.1<sup>3,7</sup>]decane, 1-chloro-3,5-dimethyl-
- 1-Chloro-3,5-dimethyltricyclo[3.3.1.13,7]decane
- Tricyclo[3.3.1.13,7]decane, 1-chloro-3,5-dimethyl-
