CAS 7071-12-7

triethyl 2-chloro-2-phosphonoacetate

Description:

Triethyl 2-chloro-2-phosphonoacetate, with the CAS number 7071-12-7, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to an acetate group and a chlorine atom. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the chloro and phosphono functional groups. It is soluble in organic solvents, which makes it useful in various chemical applications, including as a reagent in organic synthesis and in the production of phosphonate derivatives. The compound exhibits moderate toxicity, which is common among organophosphorus compounds, and it requires careful handling to avoid exposure. Its chemical structure allows it to participate in nucleophilic substitution reactions, making it valuable in the synthesis of more complex molecules. Additionally, triethyl 2-chloro-2-phosphonoacetate can serve as a building block in the development of agrochemicals and pharmaceuticals, highlighting its significance in both industrial and research settings.

Formula: C₈H₁₆ClO₅P

InChI: InChI=1/C8H16ClO5P/c1-4-12-8(10)7(9)15(11,13-5-2)14-6-3/h7H,4-6H2,1-3H3

SMILES: CCOC(=O)C(Cl)P(=O)(OCC)OCC

Synonyms:

• Ethyl Chloro(Diethoxyphosphoryl)Acetate

Triethyl 2-chloro-2-phosphonoacetate

CAS: 7071-12-7

Formula: C₈H₁₆ClO₅P

Purity: 95%

Color and Shape: Liquid

Molecular weight: 258.6364

Ref: IN-DA003V1L

Triethyl 2-chloro-2-phosphonoacetate

CAS: 7071-12-7

Triethyl 2-chloro-2-phosphonoacetate

Purity: 95%

Molecular weight: 258.64g/mol

Ref: 54-OR1041674

Ethyl 2-chloro-2-(diethoxyphosphoryl)acetate

CAS: 7071-12-7

Formula: C₈H₁₆ClO₅P

Purity: 97%

Color and Shape: Liquid, Oil

Molecular weight: 258.63

Ref: 10-F240587