CAS 70711-40-9
:Ametantrone acetate
Description:
Ametantrone acetate, with the CAS number 70711-40-9, is a synthetic compound that belongs to the anthraquinone class of chemicals. It is primarily known for its application in the field of medicinal chemistry, particularly as an antineoplastic agent, which means it is used in cancer treatment. The compound exhibits properties that allow it to intercalate into DNA, disrupting the replication process of rapidly dividing cells, which is a characteristic feature of many chemotherapeutic agents. Ametantrone acetate is typically characterized by its specific molecular structure, which includes a fused ring system that contributes to its biological activity. Additionally, it may possess various functional groups that influence its solubility, stability, and interaction with biological targets. Safety and handling precautions are essential when working with this compound, as it may have associated toxicological effects. Overall, ametantrone acetate represents a significant compound in the ongoing research and development of cancer therapies.
Formula:C22H28N4O4·2C2H4O2
InChI:InChI=1S/C22H28N4O4.C2H4O2/c27-13-11-23-7-9-25-17-5-6-18(26-10-8-24-12-14-28)20-19(17)21(29)15-3-1-2-4-16(15)22(20)30;1-2(3)4/h1-6,23-28H,7-14H2;1H3,(H,3,4)
InChI key:InChIKey=IAGMBSXKAGFBJT-UHFFFAOYSA-N
SMILES:N(CCNCCO)C1=C2C(=C(NCCNCCO)C=C1)C(=O)C=3C(C2=O)=CC=CC3.C(C)(O)=O
Synonyms:- Ametantrone acetate
- 9,10-Anthracenedione, 1,4-bis[[2-[(2-hydroxyethyl)amino]ethyl]amino]-, acetate (1:2)
- NSC 287513
- 9,10-Anthracenedione, 1,4-bis[[2-[(2-hydroxyethyl)amino]ethyl]amino]-, diacetate (salt)
- CI 881
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ametantrone Acetate
CAS:<p>Ametantrone Acetate is a topoisomerase II inhibitor of anthrapyrazole family, which can lead to DNA covalent crosslinking.</p>Formula:C24H32N4O6Color and Shape:SolidMolecular weight:472.542
