CAS 70713-45-0
:1-(diphenylmethyl)-4-(prop-2-en-1-yl)piperazine dihydrochloride
Description:
1-(Diphenylmethyl)-4-(prop-2-en-1-yl)piperazine dihydrochloride, with the CAS number 70713-45-0, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a diphenylmethyl group and a propenyl substituent, contributing to its unique structural properties. It is typically encountered as a dihydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the diphenylmethyl group may impart significant lipophilicity, influencing its biological activity and potential applications in medicinal chemistry. The compound may exhibit various pharmacological effects, making it of interest in drug development and research. Its synthesis and characterization involve standard organic chemistry techniques, and it is essential to handle it with care, adhering to safety protocols due to potential biological activity. As with many piperazine derivatives, it may interact with neurotransmitter systems, warranting further investigation into its therapeutic potential and mechanisms of action.
Formula:C20H26Cl2N2
InChI:InChI=1/C20H24N2.2ClH/c1-2-13-21-14-16-22(17-15-21)20(18-9-5-3-6-10-18)19-11-7-4-8-12-19;;/h2-12,20H,1,13-17H2;2*1H
Synonyms:- 1-(diphenylmethyl)-4-(2-propenyl)piperazine, dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Aligeron
CAS:Controlled ProductAligeron is a natural alkaloid compound, which is derived from specific plant sources known for their medicinal properties. This compound functions through the inhibition of inflammatory pathways, specifically targeting mediators involved in the inflammatory response. Aligeron disrupts the activity of enzymes and signaling molecules that precipitate inflammation, thereby modulating the immune response to reduce inflammation and promote healing.Formula:C20H24N2Purity:Min. 95%Molecular weight:292.4 g/molAligeron
CAS:Aligeron is a non-selective prostaglandin (PG) antagonist that inhibits PGF2α- and PGE2-induced decreases in blood pressure in cats, and can be used to inhibitFormula:C20H24N2Purity:99.09% - >99.99%Color and Shape:SolidMolecular weight:292.42


