CAS 7072-94-8
:2-chloro-N-(3-chloro-4-methoxyphenyl)acetamide
Description:
2-Chloro-N-(3-chloro-4-methoxyphenyl)acetamide, with the CAS number 7072-94-8, is an organic compound characterized by its acetamide functional group and the presence of chlorine and methoxy substituents on the aromatic ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its polar nature due to the amide group. The presence of chlorine atoms contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry. The methoxy group enhances the lipophilicity of the molecule, which can influence its pharmacokinetic properties. Additionally, the compound may exhibit specific interactions with biological targets, potentially leading to applications in pharmaceuticals or agrochemicals. Its synthesis and handling require standard laboratory safety protocols due to the presence of halogenated compounds, which can pose environmental and health risks. Overall, 2-chloro-N-(3-chloro-4-methoxyphenyl)acetamide is a compound of interest for further research and development in various chemical applications.
Formula:C9H9Cl2NO2
InChI:InChI=1/C9H9Cl2NO2/c1-14-8-3-2-6(4-7(8)11)12-9(13)5-10/h2-4H,5H2,1H3,(H,12,13)
SMILES:COc1ccc(cc1Cl)N=C(CCl)O
Synonyms:- acetamide, 2-chloro-N-(3-chloro-4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
