CAS 70724-24-2

Carbamic acid, ethyl-, 4-piperidinyl ester

Description:

Carbamic acid, ethyl-, 4-piperidinyl ester, with the CAS number 70724-24-2, is an organic compound that belongs to the class of carbamates. This substance features a carbamic acid moiety where an ethyl group is esterified to the nitrogen of a piperidine ring. It is typically characterized by its moderate polarity, which allows it to interact with both polar and nonpolar environments. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals and agrochemicals. The compound may exhibit properties such as being a potential inhibitor or modulator of certain biological pathways, although specific biological activities can vary. In terms of physical properties, carbamates generally have moderate boiling points and solubility in organic solvents. Safety data should be consulted for handling and exposure guidelines, as carbamates can exhibit varying degrees of toxicity. Overall, this compound's structure suggests potential utility in medicinal chemistry and related fields.

Formula: C₈H₁₆N₂O₂

InChI: InChI=1S/C8H16N2O2/c1-2-10-8(11)12-7-3-5-9-6-4-7/h7,9H,2-6H2,1H3,(H,10,11)

InChI key: InChIKey=JIYLLYLKTJCEEL-UHFFFAOYSA-N

SMILES: O(C(NCC)=O)C1CCNCC1

Synonyms:

• Carbamic acid, ethyl-, 4-piperidinyl ester

Piperidin-4-yl ethylcarbamate

CAS: 70724-24-2

Formula: C₈H₁₆N₂O₂

Color and Shape: Liquid

Molecular weight: 172.2248

Ref: IN-DA005GNX

Ethylcarbamic Acid 4-Piperidinyl-d4 Ester

Controlled Product

CAS: 70724-24-2

Applications A useful reactant in the preparation labelled Carbazeran (C175792), a phosphodiesterase inhibitor drug.

Formula: C₈D₄H₁₂N₂O₂

Color and Shape: Neat

Molecular weight: 176.25

Ref: TR-E900912