CAS 70724-25-3: Carbazeran
Description:Carbazeran, with the CAS number 70724-25-3, is a chemical compound primarily recognized for its application as a fungicide in agricultural practices. It belongs to the class of compounds known as benzimidazoles, which are characterized by their efficacy against a broad spectrum of fungal pathogens. The structure of Carbazeran features a benzimidazole core, which contributes to its biological activity. This compound is typically used to protect crops from various fungal diseases, enhancing agricultural productivity. In terms of its physical properties, Carbazeran is generally a solid at room temperature and may exhibit moderate solubility in organic solvents. Its mode of action involves inhibiting fungal cell division, thereby preventing the growth and spread of fungi. As with many agrochemicals, safety and environmental impact assessments are crucial, and appropriate handling measures should be observed to mitigate any potential risks associated with its use. Overall, Carbazeran plays a significant role in modern agriculture, contributing to effective crop management strategies.
Formula:C18H24N4O4
InChI:InChI=1S/C18H24N4O4/c1-4-19-18(23)26-13-5-7-22(8-6-13)17-14-10-16(25-3)15(24-2)9-12(14)11-20-21-17/h9-11,13H,4-8H2,1-3H3,(H,19,23)
InChI key:InChIKey=QJGVXJYGDBSPSJ-UHFFFAOYSA-N
SMILES:O=C(OC1CCN(C2=NN=CC=3C=C(OC)C(OC)=CC23)CC1)NCC
- Synonyms:
- 1-(6,7-Dimethoxyphthalazin-1-yl)piperidin-4-yl ethylcarbamate
- 70724-25-3
- Carbamic acid, ethyl-, 1-(6,7-dimethoxy-1-phthalazinyl)-4-piperidinyl ester
- Ethylcarbamic Acid 1-(6,7-Dimethoxy-1-phthalazinyl)-4-piperidinyl Ester
- Uk 31557
- carbamic acid, N-ethyl-, 1-(6,7-dimethoxy-1-phthalazinyl)-4-piperidinyl ester
- Carbazeran
